C29H31N5O5S — CID 173428549
2,3-di(propan-2-yl)naphthalene-1-sulfonic acid;5-nitro-2,3-diphenyl-1H-tetrazole (PubChem CID 173428549) has the molecular formula C29H31N5O5S and a molecular weight of 561.66 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)naphthalene-1-sulfonic acid;5-nitro-2,3-diphenyl-1H-tetrazole.
| Compound Name | 2,3-di(propan-2-yl)naphthalene-1-sulfonic acid;5-nitro-2,3-diphenyl-1H-tetrazole |
|---|---|
| PubChem CID | 173428549 |
| Molecular Formula | C29H31N5O5S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2,3-di(propan-2-yl)naphthalene-1-sulfonic acid;5-nitro-2,3-diphenyl-1H-tetrazole |
| SMILES | CC(C)c1cc2ccccc2c(S(=O)(=O)O)c1C(C)C.O=[N+]([O-])C1=NN(c2ccccc2)N(c2ccccc2)N1 |
| InChI | InChI=1S/C16H20O3S.C13H11N5O2/c1-10(2)14-9-12-7-5-6-8-13(12)16(20(17,18)19)15(14)11(3)4;19-18(20)13-14-16(11-7-3-1-4-8-11)17(15-13)12-9-5-2-6-10-12/h5-11H,1-4H3,(H,17,18,19);1-10H,(H,14,15) |
| InChIKey | GOHDJWRMRBFAMK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|