C12H19ClN8OS — CID 173428712
3-amino-6-chloro-5-(propan-2-ylamino)-N-[(1,3-thiazolidin-2-ylhydrazinylidene)methyl]pyrazine-2-carboxamide (PubChem CID 173428712) has the molecular formula C12H19ClN8OS and a molecular weight of 358.86 g/mol. Its IUPAC name is 3-amino-6-chloro-5-(propan-2-ylamino)-N-[(1,3-thiazolidin-2-ylhydrazinylidene)methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-5-(propan-2-ylamino)-N-[(1,3-thiazolidin-2-ylhydrazinylidene)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 173428712 |
| Molecular Formula | C12H19ClN8OS |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-amino-6-chloro-5-(propan-2-ylamino)-N-[(1,3-thiazolidin-2-ylhydrazinylidene)methyl]pyrazine-2-carboxamide |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NC=NNC2NCCS2)nc1Cl |
| InChI | InChI=1S/C12H19ClN8OS/c1-6(2)18-10-8(13)19-7(9(14)20-10)11(22)16-5-17-21-12-15-3-4-23-12/h5-6,12,15,21H,3-4H2,1-2H3,(H3,14,18,20)(H,16,17,22) |
| InChIKey | YPSHZWMSXJQQML-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|