C11H20F3N3O3PS+ — CID 173428722
[[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(propylamino)methyl]-sulfanylidenephosphanium (PubChem CID 173428722) has the molecular formula C11H20F3N3O3PS+ and a molecular weight of 362.33 g/mol. Its IUPAC name is [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(propylamino)methyl]-sulfanylidenephosphanium.
| Compound Name | [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(propylamino)methyl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 173428722 |
| Molecular Formula | C11H20F3N3O3PS+ |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [[carboxymethyl-(2,2,2-trifluoroacetyl)amino]-bis(propylamino)methyl]-sulfanylidenephosphanium |
| SMILES | CCCNC(NCCC)([PH+]=S)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N3O3PS/c1-3-5-15-11(21-22,16-6-4-2)17(7-8(18)19)9(20)10(12,13)14/h15-16H,3-7H2,1-2H3,(H,18,19)/p+1 |
| InChIKey | FTHJPHDDHRPZKK-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|