About lithium;hydride;sulfo aziridine-2-carboxylate
lithium;hydride;sulfo aziridine-2-carboxylate (PubChem CID 173429078) has the molecular formula C3H6LiNO5S
and a molecular weight of 175.09 g/mol. Its IUPAC name is lithium;hydride;sulfo aziridine-2-carboxylate.
Molecular Properties
| Compound Name | lithium;hydride;sulfo aziridine-2-carboxylate |
| PubChem CID | 173429078 |
| Molecular Formula | C3H6LiNO5S |
| Molecular Weight | 175.09 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | lithium;hydride;sulfo aziridine-2-carboxylate |
| SMILES | O=C(OS(=O)(=O)O)C1CN1.[H-].[Li+] |
| InChI | InChI=1S/C3H5NO5S.Li.H/c5-3(2-1-4-2)9-10(6,7)8;;/h2,4H,1H2,(H,6,7,8);;/q;+1;-1 |
| InChIKey | AJBWGSYREMUPSH-UHFFFAOYSA-N |
| XLogP | -4.58 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.09 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;sulfo aziridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;sulfo aziridine-2-carboxylate?
The IUPAC name of lithium;hydride;sulfo aziridine-2-carboxylate (CID 173429078) is lithium;hydride;sulfo aziridine-2-carboxylate.
What is the SMILES notation for lithium;hydride;sulfo aziridine-2-carboxylate?
The canonical SMILES for lithium;hydride;sulfo aziridine-2-carboxylate is O=C(OS(=O)(=O)O)C1CN1.[H-].[Li+].
What is the InChIKey of lithium;hydride;sulfo aziridine-2-carboxylate?
The InChIKey is AJBWGSYREMUPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO5S.Li.H/c5-3(2-1-4-2)9-10(6,7)8;;/h2,4H,1H2,(H,6,7,8);;/q;+1;-1.
What are the key properties of lithium;hydride;sulfo aziridine-2-carboxylate?
lithium;hydride;sulfo aziridine-2-carboxylate has a molecular weight of 175.09 g/mol, XLogP of -4.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;sulfo aziridine-2-carboxylate is sourced from PubChem (CID 173429078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).