C19H22N12OS4 — CID 173430155
2-[4-[2-[[4-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]anilino]-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 173430155) has the molecular formula C19H22N12OS4 and a molecular weight of 562.74 g/mol. Its IUPAC name is 2-[4-[2-[[4-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]anilino]-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-[[4-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]anilino]-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 173430155 |
| Molecular Formula | C19H22N12OS4 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 2-[4-[2-[[4-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]anilino]-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CSCC/N=c2\[nH][s+]([O-])nc2Nc2cccc(-c3csc(N=C(N)N)n3)c2)cs1 |
| InChI | InChI=1S/C19H22N12OS4/c20-16(21)28-18-26-12(8-34-18)7-33-5-4-24-14-15(31-36(32)30-14)25-11-3-1-2-10(6-11)13-9-35-19(27-13)29-17(22)23/h1-3,6,8-9H,4-5,7H2,(H,24,30)(H,25,31)(H4,20,21,26,28)(H4,22,23,27,29) |
| InChIKey | JCGCWWHYLXWKFR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 230.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|