About methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide
methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide (PubChem CID 173430356) has the molecular formula C8H13IN4S
and a molecular weight of 324.19 g/mol. Its IUPAC name is methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide |
| PubChem CID | 173430356 |
| Molecular Formula | C8H13IN4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide |
| SMILES | CS/C(N)=N\c1cc(C)nc(C)n1.I |
| InChI | InChI=1S/C8H12N4S.HI/c1-5-4-7(11-6(2)10-5)12-8(9)13-3;/h4H,1-3H3,(H2,9,10,11,12);1H |
| InChIKey | KRHURFWJPSFNGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide?
The IUPAC name of methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide (CID 173430356) is methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide.
What is the SMILES notation for methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide?
The canonical SMILES for methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide is CS/C(N)=N\c1cc(C)nc(C)n1.I.
What is the InChIKey of methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide?
The InChIKey is KRHURFWJPSFNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4S.HI/c1-5-4-7(11-6(2)10-5)12-8(9)13-3;/h4H,1-3H3,(H2,9,10,11,12);1H.
What are the key properties of methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide?
methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide has a molecular weight of 324.19 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(2,6-dimethylpyrimidin-4-yl)carbamimidothioate;hydroiodide is sourced from PubChem (CID 173430356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).