About N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine (PubChem CID 173430633) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine.
Molecular Properties
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine |
| PubChem CID | 173430633 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine |
| SMILES | CC1(C)OCC(CON=Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H17NO3/c1-13(2)15-9-12(17-13)10-16-14-8-11-6-4-3-5-7-11/h3-8,12H,9-10H2,1-2H3 |
| InChIKey | FHVIFLMFVLLMAK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine?
The IUPAC name of N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine (CID 173430633) is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine.
What is the SMILES notation for N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine?
The canonical SMILES for N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine is CC1(C)OCC(CON=Cc2ccccc2)O1.
What is the InChIKey of N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine?
The InChIKey is FHVIFLMFVLLMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-13(2)15-9-12(17-13)10-16-14-8-11-6-4-3-5-7-11/h3-8,12H,9-10H2,1-2H3.
What are the key properties of N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine?
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine has a molecular weight of 235.28 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-1-phenylmethanimine is sourced from PubChem (CID 173430633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).