C13H24 — CID 173431731
cis-(2S,3R)-2-[(E)-but-2-enyl]-1,1,3-trimethylcyclohexane (PubChem CID 173431731) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is cis-(2S,3R)-2-[(E)-but-2-enyl]-1,1,3-trimethylcyclohexane.
| Compound Name | cis-(2S,3R)-2-[(E)-but-2-enyl]-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 173431731 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | cis-(2S,3R)-2-[(E)-but-2-enyl]-1,1,3-trimethylcyclohexane |
| SMILES | C/C=C/C[C@H]1[C@H](C)CCCC1(C)C |
| InChI | InChI=1S/C13H24/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h5-6,11-12H,7-10H2,1-4H3/b6-5+/t11-,12+/m1/s1 |
| InChIKey | SJSPKMBQQARKSE-AIIUZBJTSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|