About CID 173431804
CID 173431804 (PubChem CID 173431804) has the molecular formula C14H27GeN2O4
and a molecular weight of 359.99 g/mol.
Molecular Properties
| Compound Name | CID 173431804 |
| PubChem CID | 173431804 |
| Molecular Formula | C14H27GeN2O4 |
| Molecular Weight | 359.99 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | — |
| SMILES | CCN(CC)CCC(=O)N(C)c1ccc([Ge])cc1.O.O.O |
| InChI | InChI=1S/C14H21GeN2O.3H2O/c1-4-17(5-2)11-10-14(18)16(3)13-8-6-12(15)7-9-13;;;/h6-9H,4-5,10-11H2,1-3H3;3*1H2 |
| InChIKey | KNULCBRGAZDYFU-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 118.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.99 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 173431804 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173431804?
The IUPAC name of CID 173431804 (CID 173431804) is not available.
What is the SMILES notation for CID 173431804?
The canonical SMILES for CID 173431804 is CCN(CC)CCC(=O)N(C)c1ccc([Ge])cc1.O.O.O.
What is the InChIKey of CID 173431804?
The InChIKey is KNULCBRGAZDYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21GeN2O.3H2O/c1-4-17(5-2)11-10-14(18)16(3)13-8-6-12(15)7-9-13;;;/h6-9H,4-5,10-11H2,1-3H3;3*1H2.
What are the key properties of CID 173431804?
CID 173431804 has a molecular weight of 359.99 g/mol, XLogP of -1.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173431804 is sourced from PubChem (CID 173431804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).