C11H18N4O2 — CID 173432374
[[2,2-dimethyl-3-(3-methylpyrazol-1-yl)butylidene]amino] carbamate (PubChem CID 173432374) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is [[2,2-dimethyl-3-(3-methylpyrazol-1-yl)butylidene]amino] carbamate.
| Compound Name | [[2,2-dimethyl-3-(3-methylpyrazol-1-yl)butylidene]amino] carbamate |
|---|---|
| PubChem CID | 173432374 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [[2,2-dimethyl-3-(3-methylpyrazol-1-yl)butylidene]amino] carbamate |
| SMILES | Cc1ccn(C(C)C(C)(C)C=NOC(N)=O)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-5-6-15(14-8)9(2)11(3,4)7-13-17-10(12)16/h5-7,9H,1-4H3,(H2,12,16) |
| InChIKey | JZRBLQDVEJHGOQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|