About sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one
sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one (PubChem CID 173432403) has the molecular formula C10H13N2NaO
and a molecular weight of 200.22 g/mol. Its IUPAC name is sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one |
| PubChem CID | 173432403 |
| Molecular Formula | C10H13N2NaO |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one |
| SMILES | C=C(C)N1C(=O)NC2CC=CC=C21.[H-].[Na+] |
| InChI | InChI=1S/C10H12N2O.Na.H/c1-7(2)12-9-6-4-3-5-8(9)11-10(12)13;;/h3-4,6,8H,1,5H2,2H3,(H,11,13);;/q;+1;-1 |
| InChIKey | UEXKSTFKLBHESC-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one?
The IUPAC name of sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one (CID 173432403) is sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one.
What is the SMILES notation for sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one?
The canonical SMILES for sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one is C=C(C)N1C(=O)NC2CC=CC=C21.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one?
The InChIKey is UEXKSTFKLBHESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.Na.H/c1-7(2)12-9-6-4-3-5-8(9)11-10(12)13;;/h3-4,6,8H,1,5H2,2H3,(H,11,13);;/q;+1;-1.
What are the key properties of sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one?
sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one has a molecular weight of 200.22 g/mol, XLogP of -1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-prop-1-en-2-yl-7,7a-dihydro-1H-benzimidazol-2-one is sourced from PubChem (CID 173432403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).