About (4-methyl-2,6-diphenylphenyl)stibane
(4-methyl-2,6-diphenylphenyl)stibane (PubChem CID 173432730) has the molecular formula C19H17Sb
and a molecular weight of 367.11 g/mol. Its IUPAC name is (4-methyl-2,6-diphenylphenyl)stibane.
Molecular Properties
| Compound Name | (4-methyl-2,6-diphenylphenyl)stibane |
| PubChem CID | 173432730 |
| Molecular Formula | C19H17Sb |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (4-methyl-2,6-diphenylphenyl)stibane |
| SMILES | Cc1cc(-c2ccccc2)c([SbH2])c(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H15.Sb.2H/c1-15-12-18(16-8-4-2-5-9-16)14-19(13-15)17-10-6-3-7-11-17;;;/h2-13H,1H3;;; |
| InChIKey | DSAJYMFISORTTG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2,6-diphenylphenyl)stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2,6-diphenylphenyl)stibane?
The IUPAC name of (4-methyl-2,6-diphenylphenyl)stibane (CID 173432730) is (4-methyl-2,6-diphenylphenyl)stibane.
What is the SMILES notation for (4-methyl-2,6-diphenylphenyl)stibane?
The canonical SMILES for (4-methyl-2,6-diphenylphenyl)stibane is Cc1cc(-c2ccccc2)c([SbH2])c(-c2ccccc2)c1.
What is the InChIKey of (4-methyl-2,6-diphenylphenyl)stibane?
The InChIKey is DSAJYMFISORTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.Sb.2H/c1-15-12-18(16-8-4-2-5-9-16)14-19(13-15)17-10-6-3-7-11-17;;;/h2-13H,1H3;;;.
What are the key properties of (4-methyl-2,6-diphenylphenyl)stibane?
(4-methyl-2,6-diphenylphenyl)stibane has a molecular weight of 367.11 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2,6-diphenylphenyl)stibane is sourced from PubChem (CID 173432730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).