About sodium;N-benzyl-2-cyanoacetamide;hydride
sodium;N-benzyl-2-cyanoacetamide;hydride (PubChem CID 173433462) has the molecular formula C10H11N2NaO
and a molecular weight of 198.20 g/mol. Its IUPAC name is sodium;N-benzyl-2-cyanoacetamide;hydride.
Molecular Properties
| Compound Name | sodium;N-benzyl-2-cyanoacetamide;hydride |
| PubChem CID | 173433462 |
| Molecular Formula | C10H11N2NaO |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | sodium;N-benzyl-2-cyanoacetamide;hydride |
| SMILES | N#CCC(=O)NCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C10H10N2O.Na.H/c11-7-6-10(13)12-8-9-4-2-1-3-5-9;;/h1-5H,6,8H2,(H,12,13);;/q;+1;-1 |
| InChIKey | BMLFIUZILIKYMR-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;N-benzyl-2-cyanoacetamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N-benzyl-2-cyanoacetamide;hydride?
The IUPAC name of sodium;N-benzyl-2-cyanoacetamide;hydride (CID 173433462) is sodium;N-benzyl-2-cyanoacetamide;hydride.
What is the SMILES notation for sodium;N-benzyl-2-cyanoacetamide;hydride?
The canonical SMILES for sodium;N-benzyl-2-cyanoacetamide;hydride is N#CCC(=O)NCc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;N-benzyl-2-cyanoacetamide;hydride?
The InChIKey is BMLFIUZILIKYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.Na.H/c11-7-6-10(13)12-8-9-4-2-1-3-5-9;;/h1-5H,6,8H2,(H,12,13);;/q;+1;-1.
What are the key properties of sodium;N-benzyl-2-cyanoacetamide;hydride?
sodium;N-benzyl-2-cyanoacetamide;hydride has a molecular weight of 198.20 g/mol, XLogP of -1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N-benzyl-2-cyanoacetamide;hydride is sourced from PubChem (CID 173433462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).