C7H16Cl2O3Si — CID 173433650
(2,4-dichloro-1-ethoxy-1-methoxybutoxy)silane (PubChem CID 173433650) has the molecular formula C7H16Cl2O3Si and a molecular weight of 247.19 g/mol. Its IUPAC name is (2,4-dichloro-1-ethoxy-1-methoxybutoxy)silane.
| Compound Name | (2,4-dichloro-1-ethoxy-1-methoxybutoxy)silane |
|---|---|
| PubChem CID | 173433650 |
| Molecular Formula | C7H16Cl2O3Si |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (2,4-dichloro-1-ethoxy-1-methoxybutoxy)silane |
| SMILES | CCOC(OC)(O[SiH3])C(Cl)CCCl |
| InChI | InChI=1S/C7H16Cl2O3Si/c1-3-11-7(10-2,12-13)6(9)4-5-8/h6H,3-5H2,1-2,13H3 |
| InChIKey | ILUUQEIWMIKQMG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|