C5H7N3O2S — CID 173434141
1-methyl-4,6-dioxo-1,3,5-triazinane-2-carbothialdehyde (PubChem CID 173434141) has the molecular formula C5H7N3O2S and a molecular weight of 173.20 g/mol. Its IUPAC name is 1-methyl-4,6-dioxo-1,3,5-triazinane-2-carbothialdehyde.
| Compound Name | 1-methyl-4,6-dioxo-1,3,5-triazinane-2-carbothialdehyde |
|---|---|
| PubChem CID | 173434141 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 1-methyl-4,6-dioxo-1,3,5-triazinane-2-carbothialdehyde |
| SMILES | CN1C(=O)NC(=O)NC1C=S |
| InChI | InChI=1S/C5H7N3O2S/c1-8-3(2-11)6-4(9)7-5(8)10/h2-3H,1H3,(H2,6,7,9,10) |
| InChIKey | UQTROTMWNAYFHE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|