About (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane
(3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane (PubChem CID 173434548) has the molecular formula C8H12SSn
and a molecular weight of 258.96 g/mol. Its IUPAC name is (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane.
Molecular Properties
| Compound Name | (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane |
| PubChem CID | 173434548 |
| Molecular Formula | C8H12SSn |
| Molecular Weight | 258.96 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane |
| SMILES | Cc1sc(C[SnH])c(C)c1C |
| InChI | InChI=1S/C8H11S.Sn.H/c1-5-6(2)8(4)9-7(5)3;;/h3H2,1-2,4H3;; |
| InChIKey | YXOVOMQRSHTMJB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.96 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane?
The IUPAC name of (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane (CID 173434548) is (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane.
What is the SMILES notation for (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane?
The canonical SMILES for (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane is Cc1sc(C[SnH])c(C)c1C.
What is the InChIKey of (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane?
The InChIKey is YXOVOMQRSHTMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11S.Sn.H/c1-5-6(2)8(4)9-7(5)3;;/h3H2,1-2,4H3;;.
What are the key properties of (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane?
(3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane has a molecular weight of 258.96 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trimethylthiophen-2-yl)methyl-λ2-stannane is sourced from PubChem (CID 173434548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).