About 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride
2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride (PubChem CID 173435603) has the molecular formula C6H12ClNS
and a molecular weight of 165.69 g/mol. Its IUPAC name is 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride.
Analyze 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride?
The IUPAC name of 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride (CID 173435603) is 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride.
What is the SMILES notation for 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride?
The canonical SMILES for 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride is CC1SC=CCN1C.Cl.
What is the InChIKey of 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride?
The InChIKey is DLJGRHTVTOQTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS.ClH/c1-6-7(2)4-3-5-8-6;/h3,5-6H,4H2,1-2H3;1H.
What are the key properties of 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride?
2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride has a molecular weight of 165.69 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2,4-dihydro-1,3-thiazine;hydrochloride is sourced from PubChem (CID 173435603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).