C9H17NO — CID 173435638
5-methoxy-3-propyl-1,2,3,6-tetrahydropyridine (PubChem CID 173435638) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 5-methoxy-3-propyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-methoxy-3-propyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 173435638 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 5-methoxy-3-propyl-1,2,3,6-tetrahydropyridine |
| SMILES | CCCC1C=C(OC)CNC1 |
| InChI | InChI=1S/C9H17NO/c1-3-4-8-5-9(11-2)7-10-6-8/h5,8,10H,3-4,6-7H2,1-2H3 |
| InChIKey | ISEADUXPRYRYRQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |