C17H30O3 — CID 173435818
11,11-diethoxy-2,6-dimethylundeca-2,6-dienal (PubChem CID 173435818) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 11,11-diethoxy-2,6-dimethylundeca-2,6-dienal.
| Compound Name | 11,11-diethoxy-2,6-dimethylundeca-2,6-dienal |
|---|---|
| PubChem CID | 173435818 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 11,11-diethoxy-2,6-dimethylundeca-2,6-dienal |
| SMILES | CCOC(CCCC=C(C)CCC=C(C)C=O)OCC |
| InChI | InChI=1S/C17H30O3/c1-5-19-17(20-6-2)13-8-7-10-15(3)11-9-12-16(4)14-18/h10,12,14,17H,5-9,11,13H2,1-4H3 |
| InChIKey | YXNFPKZOKDWORW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|