C30H32Br2N8 — CID 173436491
5-[4-(2,3-diphenyl-1H-tetrazol-5-yl)butyl]-2,3-diphenyl-1H-tetrazole;dihydrobromide (PubChem CID 173436491) has the molecular formula C30H32Br2N8 and a molecular weight of 664.45 g/mol. Its IUPAC name is 5-[4-(2,3-diphenyl-1H-tetrazol-5-yl)butyl]-2,3-diphenyl-1H-tetrazole;dihydrobromide.
| Compound Name | 5-[4-(2,3-diphenyl-1H-tetrazol-5-yl)butyl]-2,3-diphenyl-1H-tetrazole;dihydrobromide |
|---|---|
| PubChem CID | 173436491 |
| Molecular Formula | C30H32Br2N8 |
| Molecular Weight | 664.45 g/mol |
| Exact Mass | 662.11 |
| IUPAC Name | 5-[4-(2,3-diphenyl-1H-tetrazol-5-yl)butyl]-2,3-diphenyl-1H-tetrazole;dihydrobromide |
| SMILES | Br.Br.c1ccc(N2N=C(CCCCC3=NN(c4ccccc4)N(c4ccccc4)N3)NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N8.2BrH/c1-5-15-25(16-6-1)35-31-29(32-36(35)26-17-7-2-8-18-26)23-13-14-24-30-33-37(27-19-9-3-10-20-27)38(34-30)28-21-11-4-12-22-28;;/h1-12,15-22H,13-14,23-24H2,(H,31,32)(H,33,34);2*1H |
| InChIKey | IEZDHGODPZVWQO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 61.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|