About 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine
5-methoxy-1-propyl-3,6-dihydro-2H-pyridine (PubChem CID 173436904) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 173436904 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCN1CCC=C(OC)C1 |
| InChI | InChI=1S/C9H17NO/c1-3-6-10-7-4-5-9(8-10)11-2/h5H,3-4,6-8H2,1-2H3 |
| InChIKey | ITVLXKRKZKTCIR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine (CID 173436904) is 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine is CCCN1CCC=C(OC)C1.
What is the InChIKey of 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine?
The InChIKey is ITVLXKRKZKTCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-6-10-7-4-5-9(8-10)11-2/h5H,3-4,6-8H2,1-2H3.
What are the key properties of 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine?
5-methoxy-1-propyl-3,6-dihydro-2H-pyridine has a molecular weight of 155.24 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-propyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 173436904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).