About 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium
1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium (PubChem CID 173437163) has the molecular formula C9H19N2O2+
and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium.
Molecular Properties
| Compound Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium |
| PubChem CID | 173437163 |
| Molecular Formula | C9H19N2O2+ |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium |
| SMILES | C1C[NH+](CCC2OCCO2)CCN1 |
| InChI | InChI=1S/C9H18N2O2/c1(9-12-7-8-13-9)4-11-5-2-10-3-6-11/h9-10H,1-8H2/p+1 |
| InChIKey | ZRYJPBASNVAHTC-UHFFFAOYSA-O |
| XLogP | -1.76 |
| TPSA | 34.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium?
The IUPAC name of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium (CID 173437163) is 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium.
What is the SMILES notation for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium?
The canonical SMILES for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium is C1C[NH+](CCC2OCCO2)CCN1.
What is the InChIKey of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium?
The InChIKey is ZRYJPBASNVAHTC-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18N2O2/c1(9-12-7-8-13-9)4-11-5-2-10-3-6-11/h9-10H,1-8H2/p+1.
What are the key properties of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium?
1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium has a molecular weight of 187.26 g/mol, XLogP of -1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-1-ium is sourced from PubChem (CID 173437163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).