C18H22OS — CID 173437239
(2E)-3,7-dimethyl-9-(2,4,5-trimethylthiophen-3-yl)nona-2,4,6,8-tetraenal (PubChem CID 173437239) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-9-(2,4,5-trimethylthiophen-3-yl)nona-2,4,6,8-tetraenal.
| Compound Name | (2E)-3,7-dimethyl-9-(2,4,5-trimethylthiophen-3-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 173437239 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2E)-3,7-dimethyl-9-(2,4,5-trimethylthiophen-3-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC(C=Cc1c(C)sc(C)c1C)=CC=C/C(C)=C/C=O |
| InChI | InChI=1S/C18H22OS/c1-13(7-6-8-14(2)11-12-19)9-10-18-15(3)16(4)20-17(18)5/h6-12H,1-5H3/b8-6?,10-9?,13-7?,14-11+ |
| InChIKey | ORSZNNRZWVJQDP-YNKOMRPDSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|