About (2-oxocyclobutyl) formate
(2-oxocyclobutyl) formate (PubChem CID 173437285) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is (2-oxocyclobutyl) formate.
Molecular Properties
| Compound Name | (2-oxocyclobutyl) formate |
| PubChem CID | 173437285 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | (2-oxocyclobutyl) formate |
| SMILES | O=COC1CCC1=O |
| InChI | InChI=1S/C5H6O3/c6-3-8-5-2-1-4(5)7/h3,5H,1-2H2 |
| InChIKey | CFCDKWMTAPPHCM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-oxocyclobutyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclobutyl) formate?
The IUPAC name of (2-oxocyclobutyl) formate (CID 173437285) is (2-oxocyclobutyl) formate.
What is the SMILES notation for (2-oxocyclobutyl) formate?
The canonical SMILES for (2-oxocyclobutyl) formate is O=COC1CCC1=O.
What is the InChIKey of (2-oxocyclobutyl) formate?
The InChIKey is CFCDKWMTAPPHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c6-3-8-5-2-1-4(5)7/h3,5H,1-2H2.
What are the key properties of (2-oxocyclobutyl) formate?
(2-oxocyclobutyl) formate has a molecular weight of 114.10 g/mol, XLogP of -0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclobutyl) formate is sourced from PubChem (CID 173437285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).