C3HF3N3+ — CID 173438299
2,4,6-trifluoro-1,3,5-triazin-1-ium (PubChem CID 173438299) has the molecular formula C3HF3N3+ and a molecular weight of 136.06 g/mol. Its IUPAC name is 2,4,6-trifluoro-1,3,5-triazin-1-ium.
| Compound Name | 2,4,6-trifluoro-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 173438299 |
| Molecular Formula | C3HF3N3+ |
| Molecular Weight | 136.06 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | 2,4,6-trifluoro-1,3,5-triazin-1-ium |
| SMILES | Fc1nc(F)[nH+]c(F)n1 |
| InChI | InChI=1S/C3F3N3/c4-1-7-2(5)9-3(6)8-1/p+1 |
| InChIKey | VMKJWLXVLHBJNK-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.06 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |