About but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one)
but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) (PubChem CID 173438474) has the molecular formula C28H32N4O6
and a molecular weight of 520.59 g/mol. Its IUPAC name is but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one).
Molecular Properties
| Compound Name | but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) |
| PubChem CID | 173438474 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) |
| SMILES | CCc1c(C)nc2cccc(C)n2c1=O.CCc1c(C)nc2cccc(C)n2c1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C12H14N2O.C4H4O4/c2*1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;5-3(6)1-2-4(7)8/h2*5-7H,4H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UIHAPHUEOXZRRA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one)?
The IUPAC name of but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) (CID 173438474) is but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one).
What is the SMILES notation for but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one)?
The canonical SMILES for but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) is CCc1c(C)nc2cccc(C)n2c1=O.CCc1c(C)nc2cccc(C)n2c1=O.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one)?
The InChIKey is UIHAPHUEOXZRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H14N2O.C4H4O4/c2*1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;5-3(6)1-2-4(7)8/h2*5-7H,4H2,1-3H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one)?
but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) has a molecular weight of 520.59 g/mol, XLogP of 3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one) is sourced from PubChem (CID 173438474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).