C8H22O4Si2 — CID 173438610
2-(2-hydroxyethoxy)ethanol;methyl-prop-2-enyl-silyloxysilane (PubChem CID 173438610) has the molecular formula C8H22O4Si2 and a molecular weight of 238.43 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;methyl-prop-2-enyl-silyloxysilane.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;methyl-prop-2-enyl-silyloxysilane |
|---|---|
| PubChem CID | 173438610 |
| Molecular Formula | C8H22O4Si2 |
| Molecular Weight | 238.43 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;methyl-prop-2-enyl-silyloxysilane |
| SMILES | C=CC[SiH](C)O[SiH3].OCCOCCO |
| InChI | InChI=1S/C4H10O3.C4H12OSi2/c5-1-3-7-4-2-6;1-3-4-7(2)5-6/h5-6H,1-4H2;3,7H,1,4H2,2,6H3 |
| InChIKey | GPKWIUQLUKCWAY-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.43 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|