About 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron
3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron (PubChem CID 173438660) has the molecular formula C12H16N2O5S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron.
Molecular Properties
| Compound Name | 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron |
| PubChem CID | 173438660 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron |
| SMILES | CCc1c(C)nc2cccc(C)n2c1=O.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C12H14N2O.H2O4S/c1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;1-5(2,3)4/h5-7H,4H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | CWTGXBLHXDRWCC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron?
The IUPAC name of 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron (CID 173438660) is 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron.
What is the SMILES notation for 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron?
The canonical SMILES for 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron is CCc1c(C)nc2cccc(C)n2c1=O.O=S(=O)([O-])O.[H+].
What is the InChIKey of 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron?
The InChIKey is CWTGXBLHXDRWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.H2O4S/c1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;1-5(2,3)4/h5-7H,4H2,1-3H3;(H2,1,2,3,4).
What are the key properties of 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron?
3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron has a molecular weight of 300.34 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrogen sulfate;hydron is sourced from PubChem (CID 173438660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).