C14H23N5O2S2 — CID 173438807
4-[2-[[3-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-N,N-dimethyl-1-oxido-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173438807) has the molecular formula C14H23N5O2S2 and a molecular weight of 357.51 g/mol. Its IUPAC name is 4-[2-[[3-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-N,N-dimethyl-1-oxido-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 4-[2-[[3-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-N,N-dimethyl-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173438807 |
| Molecular Formula | C14H23N5O2S2 |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-[2-[[3-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-N,N-dimethyl-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | CN(C)Cc1ccoc1CSCC/N=c1\[nH][s+]([O-])nc1N(C)C |
| InChI | InChI=1S/C14H23N5O2S2/c1-18(2)9-11-5-7-21-12(11)10-22-8-6-15-13-14(19(3)4)17-23(20)16-13/h5,7H,6,8-10H2,1-4H3,(H,15,16) |
| InChIKey | QXTWGJOUOUBSBC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|