About 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine
1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine (PubChem CID 173438937) has the molecular formula C8H14N6O3
and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine.
Molecular Properties
| Compound Name | 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine |
| PubChem CID | 173438937 |
| Molecular Formula | C8H14N6O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine |
| SMILES | Cc1ncoc1CNCCNC(N)=N[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N6O3/c1-6-7(17-5-12-6)4-10-2-3-11-8(9)13-14(15)16/h5,10H,2-4H2,1H3,(H3,9,11,13) |
| InChIKey | APGDWLDZDMJQJO-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine?
The IUPAC name of 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine (CID 173438937) is 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine.
What is the SMILES notation for 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine?
The canonical SMILES for 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine is Cc1ncoc1CNCCNC(N)=N[N+](=O)[O-].
What is the InChIKey of 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine?
The InChIKey is APGDWLDZDMJQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6O3/c1-6-7(17-5-12-6)4-10-2-3-11-8(9)13-14(15)16/h5,10H,2-4H2,1H3,(H3,9,11,13).
What are the key properties of 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine?
1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine has a molecular weight of 242.24 g/mol, XLogP of -0.83, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4-methyl-1,3-oxazol-5-yl)methylamino]ethyl]-2-nitroguanidine is sourced from PubChem (CID 173438937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).