C20H24N2O2 — CID 17343902
2-(2,3-dimethylphenoxy)-N-[(E)-(2-methyl-1-phenylpropylidene)amino]acetamide (PubChem CID 17343902) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-[(E)-(2-methyl-1-phenylpropylidene)amino]acetamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-[(E)-(2-methyl-1-phenylpropylidene)amino]acetamide |
|---|---|
| PubChem CID | 17343902 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-[(E)-(2-methyl-1-phenylpropylidene)amino]acetamide |
| SMILES | Cc1cccc(OCC(=O)N/N=C(/c2ccccc2)C(C)C)c1C |
| InChI | InChI=1S/C20H24N2O2/c1-14(2)20(17-10-6-5-7-11-17)22-21-19(23)13-24-18-12-8-9-15(3)16(18)4/h5-12,14H,13H2,1-4H3,(H,21,23)/b22-20+ |
| InChIKey | HNIXISWCBPGKGW-LSDHQDQOSA-N |
| XLogP | 3.86 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|