C17H28O5 — CID 173439159
1,2,3,4,5-pentaethoxy-6-methylbenzene (PubChem CID 173439159) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1,2,3,4,5-pentaethoxy-6-methylbenzene.
| Compound Name | 1,2,3,4,5-pentaethoxy-6-methylbenzene |
|---|---|
| PubChem CID | 173439159 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1,2,3,4,5-pentaethoxy-6-methylbenzene |
| SMILES | CCOc1c(C)c(OCC)c(OCC)c(OCC)c1OCC |
| InChI | InChI=1S/C17H28O5/c1-7-18-13-12(6)14(19-8-2)16(21-10-4)17(22-11-5)15(13)20-9-3/h7-11H2,1-6H3 |
| InChIKey | GMHWVOHIKREGDX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |