C20H14Cl4F4N4O2 — CID 173439680
1-(2-fluorophenyl)-3-methyl-5-[2,3,3,3-tetrachloro-1-[4-(trifluoromethyl)anilino]propyl]iminoimidazolidine-2,4-dione (PubChem CID 173439680) has the molecular formula C20H14Cl4F4N4O2 and a molecular weight of 560.16 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-methyl-5-[2,3,3,3-tetrachloro-1-[4-(trifluoromethyl)anilino]propyl]iminoimidazolidine-2,4-dione.
| Compound Name | 1-(2-fluorophenyl)-3-methyl-5-[2,3,3,3-tetrachloro-1-[4-(trifluoromethyl)anilino]propyl]iminoimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 173439680 |
| Molecular Formula | C20H14Cl4F4N4O2 |
| Molecular Weight | 560.16 g/mol |
| Exact Mass | 557.98 |
| IUPAC Name | 1-(2-fluorophenyl)-3-methyl-5-[2,3,3,3-tetrachloro-1-[4-(trifluoromethyl)anilino]propyl]iminoimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(Nc2ccc(C(F)(F)F)cc2)C(Cl)C(Cl)(Cl)Cl)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C20H14Cl4F4N4O2/c1-31-17(33)16(32(18(31)34)13-5-3-2-4-12(13)25)30-15(14(21)19(22,23)24)29-11-8-6-10(7-9-11)20(26,27)28/h2-9,14-15,29H,1H3 |
| InChIKey | KNHOUXXOONEKOW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.16 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|