C19H18Cl3F3N4O2S — CID 173439939
3-methyl-5-[2,2,2-trichloro-1-[(1-ethylthiophen-1-yl)amino]ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 173439939) has the molecular formula C19H18Cl3F3N4O2S and a molecular weight of 529.80 g/mol. Its IUPAC name is 3-methyl-5-[2,2,2-trichloro-1-[(1-ethylthiophen-1-yl)amino]ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-5-[2,2,2-trichloro-1-[(1-ethylthiophen-1-yl)amino]ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 173439939 |
| Molecular Formula | C19H18Cl3F3N4O2S |
| Molecular Weight | 529.80 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 3-methyl-5-[2,2,2-trichloro-1-[(1-ethylthiophen-1-yl)amino]ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CCS1(NC(N=C2C(=O)N(C)C(=O)N2c2cccc(C(F)(F)F)c2)C(Cl)(Cl)Cl)C=CC=C1 |
| InChI | InChI=1S/C19H18Cl3F3N4O2S/c1-3-32(9-4-5-10-32)27-16(18(20,21)22)26-14-15(30)28(2)17(31)29(14)13-8-6-7-12(11-13)19(23,24)25/h4-11,16,27H,3H2,1-2H3 |
| InChIKey | CVXIWTRKWAHGNA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|