About cyclohexylbenzene;titanium;trihydrochloride
cyclohexylbenzene;titanium;trihydrochloride (PubChem CID 173441767) has the molecular formula C12H18Cl3Ti-
and a molecular weight of 316.50 g/mol. Its IUPAC name is cyclohexylbenzene;titanium;trihydrochloride.
Molecular Properties
| Compound Name | cyclohexylbenzene;titanium;trihydrochloride |
| PubChem CID | 173441767 |
| Molecular Formula | C12H18Cl3Ti- |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | cyclohexylbenzene;titanium;trihydrochloride |
| SMILES | Cl.Cl.Cl.[Ti].[c-]1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H15.3ClH.Ti/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;;/h5-6,9-11H,1,3-4,7-8H2;3*1H;/q-1;;;; |
| InChIKey | ZQQDAQCLESVFNH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylbenzene;titanium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylbenzene;titanium;trihydrochloride?
The IUPAC name of cyclohexylbenzene;titanium;trihydrochloride (CID 173441767) is cyclohexylbenzene;titanium;trihydrochloride.
What is the SMILES notation for cyclohexylbenzene;titanium;trihydrochloride?
The canonical SMILES for cyclohexylbenzene;titanium;trihydrochloride is Cl.Cl.Cl.[Ti].[c-]1ccc(C2CCCCC2)cc1.
What is the InChIKey of cyclohexylbenzene;titanium;trihydrochloride?
The InChIKey is ZQQDAQCLESVFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15.3ClH.Ti/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;;/h5-6,9-11H,1,3-4,7-8H2;3*1H;/q-1;;;;.
What are the key properties of cyclohexylbenzene;titanium;trihydrochloride?
cyclohexylbenzene;titanium;trihydrochloride has a molecular weight of 316.50 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylbenzene;titanium;trihydrochloride is sourced from PubChem (CID 173441767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).