C23H33NO7 — CID 173442815
[(1S,2S,6S,10S,11S,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-aminopropanoate (PubChem CID 173442815) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(1S,2S,6S,10S,11S,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-aminopropanoate.
| Compound Name | [(1S,2S,6S,10S,11S,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 173442815 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [(1S,2S,6S,10S,11S,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-aminopropanoate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)[C@@H](O)[C@]4(OC(=O)[C@H](C)N)[C@@H]([C@@H]3C=C(CO)C[C@@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C23H33NO7/c1-10-6-15-21(29,17(10)26)8-13(9-25)7-14-16-20(4,5)23(16,31-19(28)12(3)24)18(27)11(2)22(14,15)30/h6-7,11-12,14-16,18,25,27,29-30H,8-9,24H2,1-5H3/t11-,12+,14+,15-,16+,18-,21+,22-,23-/m1/s1 |
| InChIKey | HIKGTWKGYWAGIW-JVSSSUIPSA-N |
| XLogP | -0.17 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|