C20H24BrO2P — CID 173443004
3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]cyclopent-3-ene-1,2-dione;hydrobromide (PubChem CID 173443004) has the molecular formula C20H24BrO2P and a molecular weight of 407.29 g/mol. Its IUPAC name is 3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]cyclopent-3-ene-1,2-dione;hydrobromide.
| Compound Name | 3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]cyclopent-3-ene-1,2-dione;hydrobromide |
|---|---|
| PubChem CID | 173443004 |
| Molecular Formula | C20H24BrO2P |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]cyclopent-3-ene-1,2-dione;hydrobromide |
| SMILES | Br.CC(C=CC1=C(C)C(=O)C(=O)C1(C)C)=CCc1ccccc1P |
| InChI | InChI=1S/C20H23O2P.BrH/c1-13(9-11-15-7-5-6-8-17(15)23)10-12-16-14(2)18(21)19(22)20(16,3)4;/h5-10,12H,11,23H2,1-4H3;1H |
| InChIKey | HTSMWZVRYWLSNS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|