C28H35ClN8OS2 — CID 173443669
1-cyano-2-[3-(4-phenylmethoxyphenyl)prop-2-enyl]-3-[2-[[2-[(N'-propylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine;hydrochloride (PubChem CID 173443669) has the molecular formula C28H35ClN8OS2 and a molecular weight of 599.23 g/mol. Its IUPAC name is 1-cyano-2-[3-(4-phenylmethoxyphenyl)prop-2-enyl]-3-[2-[[2-[(N'-propylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine;hydrochloride.
| Compound Name | 1-cyano-2-[3-(4-phenylmethoxyphenyl)prop-2-enyl]-3-[2-[[2-[(N'-propylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 173443669 |
| Molecular Formula | C28H35ClN8OS2 |
| Molecular Weight | 599.23 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 1-cyano-2-[3-(4-phenylmethoxyphenyl)prop-2-enyl]-3-[2-[[2-[(N'-propylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine;hydrochloride |
| SMILES | CCC/N=C(\N)Nc1nc(CSCCN/C(=N/CC=Cc2ccc(OCc3ccccc3)cc2)NC#N)cs1.Cl |
| InChI | InChI=1S/C28H34N8OS2.ClH/c1-2-14-31-26(30)36-28-35-24(20-39-28)19-38-17-16-33-27(34-21-29)32-15-6-9-22-10-12-25(13-11-22)37-18-23-7-4-3-5-8-23;/h3-13,20H,2,14-19H2,1H3,(H2,32,33,34)(H3,30,31,35,36);1H |
| InChIKey | PHSPXUIFJAHMSF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|