C21H20F3N3O2 — CID 17344368
N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-2-methylpropanamide (PubChem CID 17344368) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 17344368 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1(C(F)(F)F)N=C(c2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H20F3N3O2/c1-14(2)18(28)26-20(21(22,23)24)19(29)27(13-15-9-5-3-6-10-15)17(25-20)16-11-7-4-8-12-16/h3-12,14H,13H2,1-2H3,(H,26,28) |
| InChIKey | PZYJMTIDMIVBRV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |