About 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol
3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol (PubChem CID 173444709) has the molecular formula C11H12N2O4
and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol.
Molecular Properties
| Compound Name | 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol |
| PubChem CID | 173444709 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol |
| SMILES | COc1ccc(O)cn1.O=c1[nH]cccc1O |
| InChI | InChI=1S/C6H7NO2.C5H5NO2/c1-9-6-3-2-5(8)4-7-6;7-4-2-1-3-6-5(4)8/h2-4,8H,1H3;1-3,7H,(H,6,8) |
| InChIKey | GHGOOJKTEARJAX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol?
The IUPAC name of 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol (CID 173444709) is 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol.
What is the SMILES notation for 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol?
The canonical SMILES for 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol is COc1ccc(O)cn1.O=c1[nH]cccc1O.
What is the InChIKey of 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol?
The InChIKey is GHGOOJKTEARJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C5H5NO2/c1-9-6-3-2-5(8)4-7-6;7-4-2-1-3-6-5(4)8/h2-4,8H,1H3;1-3,7H,(H,6,8).
What are the key properties of 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol?
3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol has a molecular weight of 236.23 g/mol, XLogP of 0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1H-pyridin-2-one;6-methoxypyridin-3-ol is sourced from PubChem (CID 173444709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).