About 2-propan-2-yl-1,4-dihydropyrimidin-6-ol
2-propan-2-yl-1,4-dihydropyrimidin-6-ol (PubChem CID 173444800) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-propan-2-yl-1,4-dihydropyrimidin-6-ol.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,4-dihydropyrimidin-6-ol |
| PubChem CID | 173444800 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-propan-2-yl-1,4-dihydropyrimidin-6-ol |
| SMILES | CC(C)C1=NCC=C(O)N1 |
| InChI | InChI=1S/C7H12N2O/c1-5(2)7-8-4-3-6(10)9-7/h3,5,10H,4H2,1-2H3,(H,8,9) |
| InChIKey | OLXTZWRBKOGLPL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yl-1,4-dihydropyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,4-dihydropyrimidin-6-ol?
The IUPAC name of 2-propan-2-yl-1,4-dihydropyrimidin-6-ol (CID 173444800) is 2-propan-2-yl-1,4-dihydropyrimidin-6-ol.
What is the SMILES notation for 2-propan-2-yl-1,4-dihydropyrimidin-6-ol?
The canonical SMILES for 2-propan-2-yl-1,4-dihydropyrimidin-6-ol is CC(C)C1=NCC=C(O)N1.
What is the InChIKey of 2-propan-2-yl-1,4-dihydropyrimidin-6-ol?
The InChIKey is OLXTZWRBKOGLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5(2)7-8-4-3-6(10)9-7/h3,5,10H,4H2,1-2H3,(H,8,9).
What are the key properties of 2-propan-2-yl-1,4-dihydropyrimidin-6-ol?
2-propan-2-yl-1,4-dihydropyrimidin-6-ol has a molecular weight of 140.19 g/mol, XLogP of 1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,4-dihydropyrimidin-6-ol is sourced from PubChem (CID 173444800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).