About 2,5-dimethyl-1,4-dihydropyrimidin-6-ol
2,5-dimethyl-1,4-dihydropyrimidin-6-ol (PubChem CID 173444876) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-dihydropyrimidin-6-ol.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,4-dihydropyrimidin-6-ol |
| PubChem CID | 173444876 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2,5-dimethyl-1,4-dihydropyrimidin-6-ol |
| SMILES | CC1=NCC(C)=C(O)N1 |
| InChI | InChI=1S/C6H10N2O/c1-4-3-7-5(2)8-6(4)9/h9H,3H2,1-2H3,(H,7,8) |
| InChIKey | ZEHGFCODJCANKZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-1,4-dihydropyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,4-dihydropyrimidin-6-ol?
The IUPAC name of 2,5-dimethyl-1,4-dihydropyrimidin-6-ol (CID 173444876) is 2,5-dimethyl-1,4-dihydropyrimidin-6-ol.
What is the SMILES notation for 2,5-dimethyl-1,4-dihydropyrimidin-6-ol?
The canonical SMILES for 2,5-dimethyl-1,4-dihydropyrimidin-6-ol is CC1=NCC(C)=C(O)N1.
What is the InChIKey of 2,5-dimethyl-1,4-dihydropyrimidin-6-ol?
The InChIKey is ZEHGFCODJCANKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4-3-7-5(2)8-6(4)9/h9H,3H2,1-2H3,(H,7,8).
What are the key properties of 2,5-dimethyl-1,4-dihydropyrimidin-6-ol?
2,5-dimethyl-1,4-dihydropyrimidin-6-ol has a molecular weight of 126.16 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,4-dihydropyrimidin-6-ol is sourced from PubChem (CID 173444876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).