About 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride
5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride (PubChem CID 173444972) has the molecular formula C19H13BrClN7O6
and a molecular weight of 550.71 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride |
| PubChem CID | 173444972 |
| Molecular Formula | C19H13BrClN7O6 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc([N+](=O)[O-])c(N2NC(c3ccc(Br)cc3)=NN2c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12BrN7O6.ClH/c20-13-8-6-12(7-9-13)19-21-23(14-4-2-1-3-5-14)24(22-19)18-16(26(30)31)10-15(25(28)29)11-17(18)27(32)33;/h1-11H,(H,21,22);1H |
| InChIKey | XFMFNWWBBFEZCI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride?
The IUPAC name of 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride (CID 173444972) is 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride.
What is the SMILES notation for 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride?
The canonical SMILES for 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride is Cl.O=[N+]([O-])c1cc([N+](=O)[O-])c(N2NC(c3ccc(Br)cc3)=NN2c2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride?
The InChIKey is XFMFNWWBBFEZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12BrN7O6.ClH/c20-13-8-6-12(7-9-13)19-21-23(14-4-2-1-3-5-14)24(22-19)18-16(26(30)31)10-15(25(28)29)11-17(18)27(32)33;/h1-11H,(H,21,22);1H.
What are the key properties of 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride?
5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride has a molecular weight of 550.71 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-3-phenyl-2-(2,4,6-trinitrophenyl)-1H-tetrazole;hydrochloride is sourced from PubChem (CID 173444972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).