About 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol
5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol (PubChem CID 173445037) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol.
Molecular Properties
| Compound Name | 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol |
| PubChem CID | 173445037 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol |
| SMILES | CCCC1=NCC(CC)=C(O)N1 |
| InChI | InChI=1S/C9H16N2O/c1-3-5-8-10-6-7(4-2)9(12)11-8/h12H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | YKTVSJPJXKNPMF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol?
The IUPAC name of 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol (CID 173445037) is 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol.
What is the SMILES notation for 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol?
The canonical SMILES for 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol is CCCC1=NCC(CC)=C(O)N1.
What is the InChIKey of 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol?
The InChIKey is YKTVSJPJXKNPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-3-5-8-10-6-7(4-2)9(12)11-8/h12H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol?
5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol has a molecular weight of 168.24 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-propyl-1,4-dihydropyrimidin-6-ol is sourced from PubChem (CID 173445037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).