C12H10F8O — CID 173446096
5,6,6,6-tetrafluoro-1-(5,6,6,6-tetrafluorohexa-1,4-dienoxy)hexa-1,4-diene (PubChem CID 173446096) has the molecular formula C12H10F8O and a molecular weight of 322.20 g/mol. Its IUPAC name is 5,6,6,6-tetrafluoro-1-(5,6,6,6-tetrafluorohexa-1,4-dienoxy)hexa-1,4-diene.
| Compound Name | 5,6,6,6-tetrafluoro-1-(5,6,6,6-tetrafluorohexa-1,4-dienoxy)hexa-1,4-diene |
|---|---|
| PubChem CID | 173446096 |
| Molecular Formula | C12H10F8O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5,6,6,6-tetrafluoro-1-(5,6,6,6-tetrafluorohexa-1,4-dienoxy)hexa-1,4-diene |
| SMILES | FC(=CCC=COC=CCC=C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F8O/c13-9(11(15,16)17)5-1-3-7-21-8-4-2-6-10(14)12(18,19)20/h3-8H,1-2H2 |
| InChIKey | BSHXOVMTEABUKC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|