C29H34BrO4P — CID 173446304
7-oxabicyclo[4.1.0]hepta-1,3,5-triene;[3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] acetate;hydrobromide (PubChem CID 173446304) has the molecular formula C29H34BrO4P and a molecular weight of 557.47 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;[3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] acetate;hydrobromide.
| Compound Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;[3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] acetate;hydrobromide |
|---|---|
| PubChem CID | 173446304 |
| Molecular Formula | C29H34BrO4P |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;[3,5,5-trimethyl-4-[3-methyl-5-(2-phosphanylphenyl)penta-1,3-dienyl]-2-oxocyclohex-3-en-1-yl] acetate;hydrobromide |
| SMILES | Br.CC(=O)OC1CC(C)(C)C(C=CC(C)=CCc2ccccc2P)=C(C)C1=O.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C23H29O3P.C6H4O.BrH/c1-15(10-12-18-8-6-7-9-21(18)27)11-13-19-16(2)22(25)20(26-17(3)24)14-23(19,4)5;1-2-4-6-5(3-1)7-6;/h6-11,13,20H,12,14,27H2,1-5H3;1-4H;1H |
| InChIKey | MDCZSRZSQZMZMI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|