About 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol
7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol (PubChem CID 173447125) has the molecular formula C13H6Cl3NO2
and a molecular weight of 314.56 g/mol. Its IUPAC name is 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol |
| PubChem CID | 173447125 |
| Molecular Formula | C13H6Cl3NO2 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol |
| SMILES | Oc1ccc2c(-c3ccc(Cl)c(Cl)c3)noc2c1Cl |
| InChI | InChI=1S/C13H6Cl3NO2/c14-8-3-1-6(5-9(8)15)12-7-2-4-10(18)11(16)13(7)19-17-12/h1-5,18H |
| InChIKey | FSCFEQCXEYTMFE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol?
The IUPAC name of 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol (CID 173447125) is 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol.
What is the SMILES notation for 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol?
The canonical SMILES for 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol is Oc1ccc2c(-c3ccc(Cl)c(Cl)c3)noc2c1Cl.
What is the InChIKey of 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol?
The InChIKey is FSCFEQCXEYTMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl3NO2/c14-8-3-1-6(5-9(8)15)12-7-2-4-10(18)11(16)13(7)19-17-12/h1-5,18H.
What are the key properties of 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol?
7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol has a molecular weight of 314.56 g/mol, XLogP of 5.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(3,4-dichlorophenyl)-1,2-benzoxazol-6-ol is sourced from PubChem (CID 173447125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).