About carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate
carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate (PubChem CID 173447485) has the molecular formula C12H21N3O4S2
and a molecular weight of 335.45 g/mol. Its IUPAC name is carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate |
| PubChem CID | 173447485 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate |
| SMILES | C=CCN(CC=C)C(=S)OCC(CC)[N+](=O)[O-].NC(=O)S |
| InChI | InChI=1S/C11H18N2O3S.CH3NOS/c1-4-7-12(8-5-2)11(17)16-9-10(6-3)13(14)15;2-1(3)4/h4-5,10H,1-2,6-9H2,3H3;(H3,2,3,4) |
| InChIKey | PDEVIMUYRMMSQE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate?
The IUPAC name of carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate (CID 173447485) is carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate?
The canonical SMILES for carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate is C=CCN(CC=C)C(=S)OCC(CC)[N+](=O)[O-].NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate?
The InChIKey is PDEVIMUYRMMSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S.CH3NOS/c1-4-7-12(8-5-2)11(17)16-9-10(6-3)13(14)15;2-1(3)4/h4-5,10H,1-2,6-9H2,3H3;(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate?
carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate has a molecular weight of 335.45 g/mol, XLogP of 2.01, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-(2-nitrobutyl) N,N-bis(prop-2-enyl)carbamothioate is sourced from PubChem (CID 173447485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).