About 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride
4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride (PubChem CID 173447835) has the molecular formula C12H20ClN3
and a molecular weight of 241.77 g/mol. Its IUPAC name is 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride |
| PubChem CID | 173447835 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride |
| SMILES | CCCN(CCC)C1C=CC(=[N+]=[N-])C=C1.Cl |
| InChI | InChI=1S/C12H19N3.ClH/c1-3-9-15(10-4-2)12-7-5-11(14-13)6-8-12;/h5-8,12H,3-4,9-10H2,1-2H3;1H |
| InChIKey | IFAHDYYXSAHGCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride?
The IUPAC name of 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride (CID 173447835) is 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride.
What is the SMILES notation for 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride?
The canonical SMILES for 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride is CCCN(CCC)C1C=CC(=[N+]=[N-])C=C1.Cl.
What is the InChIKey of 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride?
The InChIKey is IFAHDYYXSAHGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3.ClH/c1-3-9-15(10-4-2)12-7-5-11(14-13)6-8-12;/h5-8,12H,3-4,9-10H2,1-2H3;1H.
What are the key properties of 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride?
4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride has a molecular weight of 241.77 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazo-N,N-dipropylcyclohexa-2,5-dien-1-amine;hydrochloride is sourced from PubChem (CID 173447835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).