About azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid
azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid (PubChem CID 173448349) has the molecular formula C15H27NO3S
and a molecular weight of 301.45 g/mol. Its IUPAC name is azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid.
Molecular Properties
| Compound Name | azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid |
| PubChem CID | 173448349 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)O)c(C(C)C)c1C(C)C.N |
| InChI | InChI=1S/C15H24O3S.H3N/c1-9(2)12-7-8-13(19(16,17)18)15(11(5)6)14(12)10(3)4;/h7-11H,1-6H3,(H,16,17,18);1H3 |
| InChIKey | DBFBDRFBLSZPIR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid?
The IUPAC name of azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid (CID 173448349) is azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid.
What is the SMILES notation for azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid?
The canonical SMILES for azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid is CC(C)c1ccc(S(=O)(=O)O)c(C(C)C)c1C(C)C.N.
What is the InChIKey of azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid?
The InChIKey is DBFBDRFBLSZPIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3S.H3N/c1-9(2)12-7-8-13(19(16,17)18)15(11(5)6)14(12)10(3)4;/h7-11H,1-6H3,(H,16,17,18);1H3.
What are the key properties of azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid?
azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid has a molecular weight of 301.45 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3,4-tri(propan-2-yl)benzenesulfonic acid is sourced from PubChem (CID 173448349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).